C10H11NO3 — CID 14199074
(3-ethoxyfuro[2,3-b]pyridin-2-yl)methanol (PubChem CID 14199074) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is (3-ethoxyfuro[2,3-b]pyridin-2-yl)methanol.
| Compound Name | (3-ethoxyfuro[2,3-b]pyridin-2-yl)methanol |
|---|---|
| PubChem CID | 14199074 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (3-ethoxyfuro[2,3-b]pyridin-2-yl)methanol |
| SMILES | CCOc1c(CO)oc2ncccc12 |
| InChI | InChI=1S/C10H11NO3/c1-2-13-9-7-4-3-5-11-10(7)14-8(9)6-12/h3-5,12H,2,6H2,1H3 |
| InChIKey | YYSSDXUCHMTNAH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |