About ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride
ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride (PubChem CID 118704537) has the molecular formula C10H10ClNO4
and a molecular weight of 243.65 g/mol. Its IUPAC name is ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride.
Analyze ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride?
The IUPAC name of ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride (CID 118704537) is ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride?
The canonical SMILES for ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride is CCOC(=O)c1oc2ncccc2c1O.Cl.
What is the InChIKey of ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride?
The InChIKey is PRNWJYRDVTYNES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4.ClH/c1-2-14-10(13)8-7(12)6-4-3-5-11-9(6)15-8;/h3-5,12H,2H2,1H3;1H.
What are the key properties of ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride?
ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride has a molecular weight of 243.65 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxyfuro[2,3-b]pyridine-2-carboxylate;hydrochloride is sourced from PubChem (CID 118704537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).