C17H13N3O5 — CID 89059407
ethyl 3-[(4-nitrosobenzoyl)amino]furo[2,3-b]pyridine-2-carboxylate (PubChem CID 89059407) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is ethyl 3-[(4-nitrosobenzoyl)amino]furo[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 3-[(4-nitrosobenzoyl)amino]furo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 89059407 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | ethyl 3-[(4-nitrosobenzoyl)amino]furo[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ncccc2c1NC(=O)c1ccc(N=O)cc1 |
| InChI | InChI=1S/C17H13N3O5/c1-2-24-17(22)14-13(12-4-3-9-18-16(12)25-14)19-15(21)10-5-7-11(20-23)8-6-10/h3-9H,2H2,1H3,(H,19,21) |
| InChIKey | WUZNQKNNSWOBBF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |