C10H12N2O — CID 144655994
3-butan-2-yl-[1,2]oxazolo[5,4-b]pyridine (PubChem CID 144655994) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-butan-2-yl-[1,2]oxazolo[5,4-b]pyridine.
| Compound Name | 3-butan-2-yl-[1,2]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 144655994 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-butan-2-yl-[1,2]oxazolo[5,4-b]pyridine |
| SMILES | CCC(C)c1noc2ncccc12 |
| InChI | InChI=1S/C10H12N2O/c1-3-7(2)9-8-5-4-6-11-10(8)13-12-9/h4-7H,3H2,1-2H3 |
| InChIKey | RNKMCLFAWZUBPQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |