C11H18N2 — CID 129162816
3-butan-2-yl-N,N-dimethylpyridin-2-amine (PubChem CID 129162816) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-butan-2-yl-N,N-dimethylpyridin-2-amine.
| Compound Name | 3-butan-2-yl-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 129162816 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-butan-2-yl-N,N-dimethylpyridin-2-amine |
| SMILES | CCC(C)c1cccnc1N(C)C |
| InChI | InChI=1S/C11H18N2/c1-5-9(2)10-7-6-8-12-11(10)13(3)4/h6-9H,5H2,1-4H3 |
| InChIKey | YEDFOGXNQJQFFF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |