C19H34N2 — CID 137465666
3-dodecan-6-yl-N,N-dimethylpyridin-2-amine (PubChem CID 137465666) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 3-dodecan-6-yl-N,N-dimethylpyridin-2-amine.
| Compound Name | 3-dodecan-6-yl-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 137465666 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 3-dodecan-6-yl-N,N-dimethylpyridin-2-amine |
| SMILES | CCCCCCC(CCCCC)c1cccnc1N(C)C |
| InChI | InChI=1S/C19H34N2/c1-5-7-9-11-14-17(13-10-8-6-2)18-15-12-16-20-19(18)21(3)4/h12,15-17H,5-11,13-14H2,1-4H3 |
| InChIKey | YEQFJUSCLXWZII-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|