C16H17NO — CID 153286236
7-tert-butyl-8-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 153286236) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 7-tert-butyl-8-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 7-tert-butyl-8-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153286236 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 7-tert-butyl-8-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1c(C(C)(C)C)ccc2c1oc1ncccc12 |
| InChI | InChI=1S/C16H17NO/c1-10-13(16(2,3)4)8-7-11-12-6-5-9-17-15(12)18-14(10)11/h5-9H,1-4H3 |
| InChIKey | AFNUPSDZVRKJSG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |