C11H10O2 — CID 10654816
5,7-dimethyl-1-benzofuran-2-carbaldehyde (PubChem CID 10654816) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 5,7-dimethyl-1-benzofuran-2-carbaldehyde.
| Compound Name | 5,7-dimethyl-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 10654816 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 5,7-dimethyl-1-benzofuran-2-carbaldehyde |
| SMILES | Cc1cc(C)c2oc(C=O)cc2c1 |
| InChI | InChI=1S/C11H10O2/c1-7-3-8(2)11-9(4-7)5-10(6-12)13-11/h3-6H,1-2H3 |
| InChIKey | HVGQWIGNDNADOZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|