C19H24O2 — CID 156724733
(2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane (PubChem CID 156724733) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane.
| Compound Name | (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane |
|---|---|
| PubChem CID | 156724733 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2E)-1-(5,7-dimethyl-1-benzofuran-2-yl)-2-ethenylpenta-2,4-dien-1-ol;ethane |
| SMILES | C=C/C=C(\C=C)C(O)c1cc2cc(C)cc(C)c2o1.CC |
| InChI | InChI=1S/C17H18O2.C2H6/c1-5-7-13(6-2)16(18)15-10-14-9-11(3)8-12(4)17(14)19-15;1-2/h5-10,16,18H,1-2H2,3-4H3;1-2H3/b13-7+; |
| InChIKey | GKLSQJPOVBHILJ-FTPOTTDRSA-N |
| XLogP | 5.41 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|