C36H33BF4N2 — CID 171371417
(4R,5R)-4,5-diphenyl-1-(2-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium tetrafluoroborate (PubChem CID 171371417) has the molecular formula C36H33BF4N2 and a molecular weight of 580.48 g/mol. Its IUPAC name is (4R,5R)-4,5-diphenyl-1-(2-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium tetrafluoroborate.
| Compound Name | (4R,5R)-4,5-diphenyl-1-(2-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 171371417 |
| Molecular Formula | C36H33BF4N2 |
| Molecular Weight | 580.48 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | (4R,5R)-4,5-diphenyl-1-(2-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium tetrafluoroborate |
| SMILES | Cc1cc(C)c([N+]2=CN(c3ccccc3-c3ccccc3)[C@H](c3ccccc3)[C@H]2c2ccccc2)c(C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C36H33N2.BF4/c1-26-23-27(2)34(28(3)24-26)38-25-37(33-22-14-13-21-32(33)29-15-7-4-8-16-29)35(30-17-9-5-10-18-30)36(38)31-19-11-6-12-20-31;2-1(3,4)5/h4-25,35-36H,1-3H3;/q+1;-1/t35-,36-;/m1./s1 |
| InChIKey | MJCBMMXXGZDOHT-OZBLHQGLSA-N |
| XLogP | 10.25 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.48 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|