C17H19BF4N2 — CID 134920072
(4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate (PubChem CID 134920072) has the molecular formula C17H19BF4N2 and a molecular weight of 338.16 g/mol. Its IUPAC name is (4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate.
| Compound Name | (4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 134920072 |
| Molecular Formula | C17H19BF4N2 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate |
| SMILES | CN1C=[N+](C)[C@@H](c2ccccc2)[C@@H]1c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C17H19N2.BF4/c1-18-13-19(2)17(15-11-7-4-8-12-15)16(18)14-9-5-3-6-10-14;2-1(3,4)5/h3-13,16-17H,1-2H3;/q+1;-1/t16-,17-;/m0./s1 |
| InChIKey | HVTSORIZTFITBI-QJHJCNPRSA-N |
| XLogP | 4.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|