C29H27N2+ — CID 122220378
(4R,5S)-1,3-bis(2-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium (PubChem CID 122220378) has the molecular formula C29H27N2+ and a molecular weight of 403.55 g/mol. Its IUPAC name is (4R,5S)-1,3-bis(2-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium.
| Compound Name | (4R,5S)-1,3-bis(2-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 122220378 |
| Molecular Formula | C29H27N2+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (4R,5S)-1,3-bis(2-methylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium |
| SMILES | Cc1ccccc1N1C=[N+](c2ccccc2C)[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H27N2/c1-22-13-9-11-19-26(22)30-21-31(27-20-12-10-14-23(27)2)29(25-17-7-4-8-18-25)28(30)24-15-5-3-6-16-24/h3-21,28-29H,1-2H3/q+1/t28-,29+ |
| InChIKey | MURUSZVXPVJHHZ-ISILISOKSA-N |
| XLogP | 6.98 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|