C45H43BF4N2 — CID 118988960
(4S,5S)-1,3-bis[bis(2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate (PubChem CID 118988960) has the molecular formula C45H43BF4N2 and a molecular weight of 698.66 g/mol. Its IUPAC name is (4S,5S)-1,3-bis[bis(2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate.
| Compound Name | (4S,5S)-1,3-bis[bis(2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 118988960 |
| Molecular Formula | C45H43BF4N2 |
| Molecular Weight | 698.66 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | (4S,5S)-1,3-bis[bis(2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate |
| SMILES | Cc1ccccc1C(c1ccccc1C)N1C=[N+](C(c2ccccc2C)c2ccccc2C)[C@@H](c2ccccc2)[C@@H]1c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C45H43N2.BF4/c1-32-19-11-15-27-38(32)44(39-28-16-12-20-33(39)2)46-31-47(43(37-25-9-6-10-26-37)42(46)36-23-7-5-8-24-36)45(40-29-17-13-21-34(40)3)41-30-18-14-22-35(41)4;2-1(3,4)5/h5-31,42-45H,1-4H3;/q+1;-1/t42-,43-;/m0./s1 |
| InChIKey | QFFTYQHVKLBTFN-NJUCVNEHSA-N |
| XLogP | 11.94 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.66 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|