C67H63BF4N2 — CID 154633292
(4R,5R)-1,3-bis[4-anthracen-9-yl-2,6-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate (PubChem CID 154633292) has the molecular formula C67H63BF4N2 and a molecular weight of 983.06 g/mol. Its IUPAC name is (4R,5R)-1,3-bis[4-anthracen-9-yl-2,6-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate.
| Compound Name | (4R,5R)-1,3-bis[4-anthracen-9-yl-2,6-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 154633292 |
| Molecular Formula | C67H63BF4N2 |
| Molecular Weight | 983.06 g/mol |
| Exact Mass | 982.50 |
| IUPAC Name | (4R,5R)-1,3-bis[4-anthracen-9-yl-2,6-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium tetrafluoroborate |
| SMILES | CC(C)c1cc(-c2c3ccccc3cc3ccccc23)cc(C(C)C)c1N1C=[N+](c2c(C(C)C)cc(-c3c4ccccc4cc4ccccc34)cc2C(C)C)[C@H](c2ccccc2)[C@H]1c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C67H63N2.BF4/c1-42(2)58-37-52(62-54-31-19-15-27-48(54)35-49-28-16-20-32-55(49)62)38-59(43(3)4)66(58)68-41-69(65(47-25-13-10-14-26-47)64(68)46-23-11-9-12-24-46)67-60(44(5)6)39-53(40-61(67)45(7)8)63-56-33-21-17-29-50(56)36-51-30-18-22-34-57(51)63;2-1(3,4)5/h9-45,64-65H,1-8H3;/q+1;-1/t64-,65-;/m1./s1 |
| InChIKey | NOJMMWZWYGNNNQ-PSYBORMESA-N |
| XLogP | 20.10 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.06 |
| LogP ≤ 5 | 20.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|