C36H41N2O3S+ — CID 102166302
2-[(4S,5S)-4,5-diphenyl-3-[2,4,6-tri(propan-2-yl)phenyl]-4,5-dihydroimidazol-3-ium-1-yl]benzenesulfonic acid (PubChem CID 102166302) has the molecular formula C36H41N2O3S+ and a molecular weight of 581.80 g/mol. Its IUPAC name is 2-[(4S,5S)-4,5-diphenyl-3-[2,4,6-tri(propan-2-yl)phenyl]-4,5-dihydroimidazol-3-ium-1-yl]benzenesulfonic acid.
| Compound Name | 2-[(4S,5S)-4,5-diphenyl-3-[2,4,6-tri(propan-2-yl)phenyl]-4,5-dihydroimidazol-3-ium-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102166302 |
| Molecular Formula | C36H41N2O3S+ |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 2-[(4S,5S)-4,5-diphenyl-3-[2,4,6-tri(propan-2-yl)phenyl]-4,5-dihydroimidazol-3-ium-1-yl]benzenesulfonic acid |
| SMILES | CC(C)c1cc(C(C)C)c([N+]2=CN(c3ccccc3S(=O)(=O)O)[C@@H](c3ccccc3)[C@@H]2c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C36H40N2O3S/c1-24(2)29-21-30(25(3)4)36(31(22-29)26(5)6)38-23-37(32-19-13-14-20-33(32)42(39,40)41)34(27-15-9-7-10-16-27)35(38)28-17-11-8-12-18-28/h7-26,34-35H,1-6H3/p+1/t34-,35-/m0/s1 |
| InChIKey | VSYOBPVIHCBPGH-PXLJZGITSA-O |
| XLogP | 8.98 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|