C44H56N2O4S2 — CID 101448498
(4bS,9bS)-5,10-bis[[2,4,6-tri(propan-2-yl)phenyl]sulfonyl]-4b,9b-dihydroindolo[3,2-b]indole (PubChem CID 101448498) has the molecular formula C44H56N2O4S2 and a molecular weight of 741.08 g/mol. Its IUPAC name is (4bS,9bS)-5,10-bis[[2,4,6-tri(propan-2-yl)phenyl]sulfonyl]-4b,9b-dihydroindolo[3,2-b]indole.
| Compound Name | (4bS,9bS)-5,10-bis[[2,4,6-tri(propan-2-yl)phenyl]sulfonyl]-4b,9b-dihydroindolo[3,2-b]indole |
|---|---|
| PubChem CID | 101448498 |
| Molecular Formula | C44H56N2O4S2 |
| Molecular Weight | 741.08 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | (4bS,9bS)-5,10-bis[[2,4,6-tri(propan-2-yl)phenyl]sulfonyl]-4b,9b-dihydroindolo[3,2-b]indole |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2c3ccccc3[C@H]3[C@@H]2c2ccccc2N3S(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C44H56N2O4S2/c1-25(2)31-21-35(27(5)6)43(36(22-31)28(7)8)51(47,48)45-39-19-15-13-17-33(39)42-41(45)34-18-14-16-20-40(34)46(42)52(49,50)44-37(29(9)10)23-32(26(3)4)24-38(44)30(11)12/h13-30,41-42H,1-12H3/t41-,42-/m0/s1 |
| InChIKey | OFQGVOJCINFHML-COCZKOEFSA-N |
| XLogP | 11.63 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.08 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |