C34H36N2O4S — CID 46919014
(2S)-2-naphthalen-2-yl-3-nitro-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-quinoline (PubChem CID 46919014) has the molecular formula C34H36N2O4S and a molecular weight of 568.74 g/mol. Its IUPAC name is (2S)-2-naphthalen-2-yl-3-nitro-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-quinoline.
| Compound Name | (2S)-2-naphthalen-2-yl-3-nitro-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-quinoline |
|---|---|
| PubChem CID | 46919014 |
| Molecular Formula | C34H36N2O4S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | (2S)-2-naphthalen-2-yl-3-nitro-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-quinoline |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2c3ccccc3C=C([N+](=O)[O-])[C@@H]2c2ccc3ccccc3c2)c(C(C)C)c1 |
| InChI | InChI=1S/C34H36N2O4S/c1-21(2)28-18-29(22(3)4)34(30(19-28)23(5)6)41(39,40)35-31-14-10-9-13-26(31)20-32(36(37)38)33(35)27-16-15-24-11-7-8-12-25(24)17-27/h7-23,33H,1-6H3/t33-/m0/s1 |
| InChIKey | GTWPVIJEPZDQBL-XIFFEERXSA-N |
| XLogP | 8.78 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|