About 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole
1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole (PubChem CID 19818801) has the molecular formula C17H26N4O4S
and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole.
Molecular Properties
| Compound Name | 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole |
| PubChem CID | 19818801 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2C=CN([N+](=O)[O-])N2)c(C(C)C)c1 |
| InChI | InChI=1S/C17H26N4O4S/c1-11(2)14-9-15(12(3)4)17(16(10-14)13(5)6)26(24,25)20-8-7-19(18-20)21(22)23/h7-13,18H,1-6H3 |
| InChIKey | MYHLVBWLHWYUMO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole?
The IUPAC name of 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole (CID 19818801) is 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole.
What is the SMILES notation for 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole?
The canonical SMILES for 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole is CC(C)c1cc(C(C)C)c(S(=O)(=O)N2C=CN([N+](=O)[O-])N2)c(C(C)C)c1.
What is the InChIKey of 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole?
The InChIKey is MYHLVBWLHWYUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O4S/c1-11(2)14-9-15(12(3)4)17(16(10-14)13(5)6)26(24,25)20-8-7-19(18-20)21(22)23/h7-13,18H,1-6H3.
What are the key properties of 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole?
1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole has a molecular weight of 382.49 g/mol, XLogP of 3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-3-[2,4,6-tri(propan-2-yl)phenyl]sulfonyl-2H-triazole is sourced from PubChem (CID 19818801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).