C21H34BrNO2S — CID 135059247
2-[(1R)-1-bromoethyl]-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpyrrolidine (PubChem CID 135059247) has the molecular formula C21H34BrNO2S and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[(1R)-1-bromoethyl]-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpyrrolidine.
| Compound Name | 2-[(1R)-1-bromoethyl]-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 135059247 |
| Molecular Formula | C21H34BrNO2S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[(1R)-1-bromoethyl]-1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpyrrolidine |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2CCCC2[C@@H](C)Br)c(C(C)C)c1 |
| InChI | InChI=1S/C21H34BrNO2S/c1-13(2)17-11-18(14(3)4)21(19(12-17)15(5)6)26(24,25)23-10-8-9-20(23)16(7)22/h11-16,20H,8-10H2,1-7H3/t16-,20?/m1/s1 |
| InChIKey | YUFGFYINMFOVAE-QRIPLOBPSA-N |
| XLogP | 5.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|