C39H47N2+ — CID 59047498
(4R,5R)-1,3-bis[2,5-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium (PubChem CID 59047498) has the molecular formula C39H47N2+ and a molecular weight of 543.82 g/mol. Its IUPAC name is (4R,5R)-1,3-bis[2,5-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium.
| Compound Name | (4R,5R)-1,3-bis[2,5-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 59047498 |
| Molecular Formula | C39H47N2+ |
| Molecular Weight | 543.82 g/mol |
| Exact Mass | 543.37 |
| IUPAC Name | (4R,5R)-1,3-bis[2,5-di(propan-2-yl)phenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium |
| SMILES | CC(C)c1ccc(C(C)C)c(N2C=[N+](c3cc(C(C)C)ccc3C(C)C)[C@H](c3ccccc3)[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C39H47N2/c1-26(2)32-19-21-34(28(5)6)36(23-32)40-25-41(37-24-33(27(3)4)20-22-35(37)29(7)8)39(31-17-13-10-14-18-31)38(40)30-15-11-9-12-16-30/h9-29,38-39H,1-8H3/q+1/t38-,39-/m1/s1 |
| InChIKey | SHWGCCHBNABLDJ-LJEWAXOPSA-N |
| XLogP | 10.86 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.82 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|