About 2-propan-2-ylbenzenesulfonic acid;toluene
2-propan-2-ylbenzenesulfonic acid;toluene (PubChem CID 159050297) has the molecular formula C16H20O3S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-propan-2-ylbenzenesulfonic acid;toluene.
Molecular Properties
| Compound Name | 2-propan-2-ylbenzenesulfonic acid;toluene |
| PubChem CID | 159050297 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-propan-2-ylbenzenesulfonic acid;toluene |
| SMILES | CC(C)c1ccccc1S(=O)(=O)O.Cc1ccccc1 |
| InChI | InChI=1S/C9H12O3S.C7H8/c1-7(2)8-5-3-4-6-9(8)13(10,11)12;1-7-5-3-2-4-6-7/h3-7H,1-2H3,(H,10,11,12);2-6H,1H3 |
| InChIKey | JXEHOMRQGVTFOD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylbenzenesulfonic acid;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylbenzenesulfonic acid;toluene?
The IUPAC name of 2-propan-2-ylbenzenesulfonic acid;toluene (CID 159050297) is 2-propan-2-ylbenzenesulfonic acid;toluene.
What is the SMILES notation for 2-propan-2-ylbenzenesulfonic acid;toluene?
The canonical SMILES for 2-propan-2-ylbenzenesulfonic acid;toluene is CC(C)c1ccccc1S(=O)(=O)O.Cc1ccccc1.
What is the InChIKey of 2-propan-2-ylbenzenesulfonic acid;toluene?
The InChIKey is JXEHOMRQGVTFOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S.C7H8/c1-7(2)8-5-3-4-6-9(8)13(10,11)12;1-7-5-3-2-4-6-7/h3-7H,1-2H3,(H,10,11,12);2-6H,1H3.
What are the key properties of 2-propan-2-ylbenzenesulfonic acid;toluene?
2-propan-2-ylbenzenesulfonic acid;toluene has a molecular weight of 292.40 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylbenzenesulfonic acid;toluene is sourced from PubChem (CID 159050297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).