C14H23NO4S — CID 19828074
2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid (PubChem CID 19828074) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid.
| Compound Name | 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19828074 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid |
| SMILES | CC(C)c1ccccc1S(=O)(=O)O.CC1CNCCO1 |
| InChI | InChI=1S/C9H12O3S.C5H11NO/c1-7(2)8-5-3-4-6-9(8)13(10,11)12;1-5-4-6-2-3-7-5/h3-7H,1-2H3,(H,10,11,12);5-6H,2-4H2,1H3 |
| InChIKey | JITCEPCLTCQTAM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|