2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid

C14H23NO4S — CID 19828074

IUPAC2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid
SMILESCC(C)c1ccccc1S(=O)(=O)O.CC1CNCCO1
InChIInChI=1S/C9H12O3S.C5H11NO/c1-7(2)8-5-3-4-6-9(8)13(10,11)12;1-5-4-6-2-3-7-5/h3-7H,1-2H3,(H,10,11,12);5-6H,2-4H2,1H3
InChIKeyJITCEPCLTCQTAM-UHFFFAOYSA-N
MW301.41 g/mol
LogP2.05
Rot. Bonds2

About 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid

2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid (PubChem CID 19828074) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid.

Molecular Properties

Compound Name2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid
PubChem CID19828074
Molecular FormulaC14H23NO4S
Molecular Weight301.41 g/mol
Exact Mass301.13
IUPAC Name2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid
SMILESCC(C)c1ccccc1S(=O)(=O)O.CC1CNCCO1
InChIInChI=1S/C9H12O3S.C5H11NO/c1-7(2)8-5-3-4-6-9(8)13(10,11)12;1-5-4-6-2-3-7-5/h3-7H,1-2H3,(H,10,11,12);5-6H,2-4H2,1H3
InChIKeyJITCEPCLTCQTAM-UHFFFAOYSA-N
XLogP2.05
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.41
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid?
The IUPAC name of 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid (CID 19828074) is 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid.
What is the SMILES notation for 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid?
The canonical SMILES for 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid is CC(C)c1ccccc1S(=O)(=O)O.CC1CNCCO1.
What is the InChIKey of 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid?
The InChIKey is JITCEPCLTCQTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S.C5H11NO/c1-7(2)8-5-3-4-6-9(8)13(10,11)12;1-5-4-6-2-3-7-5/h3-7H,1-2H3,(H,10,11,12);5-6H,2-4H2,1H3.
What are the key properties of 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid?
2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid has a molecular weight of 301.41 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylmorpholine;2-propan-2-ylbenzenesulfonic acid is sourced from PubChem (CID 19828074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).