C11H15N3O4S3 — CID 174606283
2-aminosulfanyl-2-morpholin-2-yl-3H-1,3-benzothiazole-4-sulfonic acid (PubChem CID 174606283) has the molecular formula C11H15N3O4S3 and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-aminosulfanyl-2-morpholin-2-yl-3H-1,3-benzothiazole-4-sulfonic acid.
| Compound Name | 2-aminosulfanyl-2-morpholin-2-yl-3H-1,3-benzothiazole-4-sulfonic acid |
|---|---|
| PubChem CID | 174606283 |
| Molecular Formula | C11H15N3O4S3 |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-aminosulfanyl-2-morpholin-2-yl-3H-1,3-benzothiazole-4-sulfonic acid |
| SMILES | NSC1(C2CNCCO2)Nc2c(cccc2S(=O)(=O)O)S1 |
| InChI | InChI=1S/C11H15N3O4S3/c12-20-11(9-6-13-4-5-18-9)14-10-7(19-11)2-1-3-8(10)21(15,16)17/h1-3,9,13-14H,4-6,12H2,(H,15,16,17) |
| InChIKey | MSEIDKXQLVWGSO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|