C15H21N3O4S — CID 86738336
ethanesulfonic acid;1-morpholin-2-ylisoquinolin-3-amine (PubChem CID 86738336) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is ethanesulfonic acid;1-morpholin-2-ylisoquinolin-3-amine.
| Compound Name | ethanesulfonic acid;1-morpholin-2-ylisoquinolin-3-amine |
|---|---|
| PubChem CID | 86738336 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethanesulfonic acid;1-morpholin-2-ylisoquinolin-3-amine |
| SMILES | CCS(=O)(=O)O.Nc1cc2ccccc2c(C2CNCCO2)n1 |
| InChI | InChI=1S/C13H15N3O.C2H6O3S/c14-12-7-9-3-1-2-4-10(9)13(16-12)11-8-15-5-6-17-11;1-2-6(3,4)5/h1-4,7,11,15H,5-6,8H2,(H2,14,16);2H2,1H3,(H,3,4,5) |
| InChIKey | MKFQXGOFWZPUPG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|