C18H21N3O3 — CID 110089333
morpholin-4-yl-(2-morpholin-2-ylquinolin-4-yl)methanone (PubChem CID 110089333) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is morpholin-4-yl-(2-morpholin-2-ylquinolin-4-yl)methanone.
| Compound Name | morpholin-4-yl-(2-morpholin-2-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 110089333 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | morpholin-4-yl-(2-morpholin-2-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(C2CNCCO2)nc2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C18H21N3O3/c22-18(21-6-9-23-10-7-21)14-11-16(17-12-19-5-8-24-17)20-15-4-2-1-3-13(14)15/h1-4,11,17,19H,5-10,12H2 |
| InChIKey | FKTMUIXMRQWRJE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |