C17H21N3O3 — CID 124994060
N-(2-hydroxyethyl)-N-methyl-2-[(2R)-morpholin-2-yl]quinoline-4-carboxamide (PubChem CID 124994060) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-methyl-2-[(2R)-morpholin-2-yl]quinoline-4-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-N-methyl-2-[(2R)-morpholin-2-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 124994060 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(2-hydroxyethyl)-N-methyl-2-[(2R)-morpholin-2-yl]quinoline-4-carboxamide |
| SMILES | CN(CCO)C(=O)c1cc([C@H]2CNCCO2)nc2ccccc12 |
| InChI | InChI=1S/C17H21N3O3/c1-20(7-8-21)17(22)13-10-15(16-11-18-6-9-23-16)19-14-5-3-2-4-12(13)14/h2-5,10,16,18,21H,6-9,11H2,1H3/t16-/m1/s1 |
| InChIKey | QCCZYCVONBDPOZ-MRXNPFEDSA-N |
| XLogP | 0.96 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |