C31H31BF4N2 — CID 134920073
(4S,5S)-4,5-diphenyl-1,3-bis[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium tetrafluoroborate (PubChem CID 134920073) has the molecular formula C31H31BF4N2 and a molecular weight of 518.41 g/mol. Its IUPAC name is (4S,5S)-4,5-diphenyl-1,3-bis[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium tetrafluoroborate.
| Compound Name | (4S,5S)-4,5-diphenyl-1,3-bis[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 134920073 |
| Molecular Formula | C31H31BF4N2 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (4S,5S)-4,5-diphenyl-1,3-bis[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium tetrafluoroborate |
| SMILES | C[C@H](c1ccccc1)N1C=[N+]([C@H](C)c2ccccc2)[C@@H](c2ccccc2)[C@@H]1c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C31H31N2.BF4/c1-24(26-15-7-3-8-16-26)32-23-33(25(2)27-17-9-4-10-18-27)31(29-21-13-6-14-22-29)30(32)28-19-11-5-12-20-28;2-1(3,4)5/h3-25,30-31H,1-2H3;/q+1;-1/t24-,25-,30+,31+;/m1./s1 |
| InChIKey | VUNUGZWPYOEDST-WQPDRWNLSA-N |
| XLogP | 8.65 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|