C19H21BF4N2 — CID 162422674
1,3-bis[(1S)-1-phenylethyl]imidazol-1-ium tetrafluoroborate (PubChem CID 162422674) has the molecular formula C19H21BF4N2 and a molecular weight of 364.20 g/mol. Its IUPAC name is 1,3-bis[(1S)-1-phenylethyl]imidazol-1-ium tetrafluoroborate.
| Compound Name | 1,3-bis[(1S)-1-phenylethyl]imidazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 162422674 |
| Molecular Formula | C19H21BF4N2 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1,3-bis[(1S)-1-phenylethyl]imidazol-1-ium tetrafluoroborate |
| SMILES | C[C@@H](c1ccccc1)n1cc[n+]([C@@H](C)c2ccccc2)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C19H21N2.BF4/c1-16(18-9-5-3-6-10-18)20-13-14-21(15-20)17(2)19-11-7-4-8-12-19;2-1(3,4)5/h3-17H,1-2H3;/q+1;-1/t16-,17-;/m0./s1 |
| InChIKey | OCNADXKOLPPVOF-QJHJCNPRSA-N |
| XLogP | 5.29 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|