C28H24N+ — CID 132566214
1,1-diphenyl-2-[(1S)-1-phenylethyl]isoindol-2-ium (PubChem CID 132566214) has the molecular formula C28H24N+ and a molecular weight of 374.51 g/mol. Its IUPAC name is 1,1-diphenyl-2-[(1S)-1-phenylethyl]isoindol-2-ium.
| Compound Name | 1,1-diphenyl-2-[(1S)-1-phenylethyl]isoindol-2-ium |
|---|---|
| PubChem CID | 132566214 |
| Molecular Formula | C28H24N+ |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1,1-diphenyl-2-[(1S)-1-phenylethyl]isoindol-2-ium |
| SMILES | C[C@@H](c1ccccc1)[N+]1=Cc2ccccc2C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24N/c1-22(23-13-5-2-6-14-23)29-21-24-15-11-12-20-27(24)28(29,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h2-22H,1H3/q+1/t22-/m0/s1 |
| InChIKey | SAHTZEBMUIZCOL-QFIPXVFZSA-N |
| XLogP | 6.18 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|