C27H25ClN2 — CID 156599776
1,3-bis[(1S)-1-naphthalen-1-ylethyl]imidazol-1-ium chloride (PubChem CID 156599776) has the molecular formula C27H25ClN2 and a molecular weight of 412.96 g/mol. Its IUPAC name is 1,3-bis[(1S)-1-naphthalen-1-ylethyl]imidazol-1-ium chloride.
| Compound Name | 1,3-bis[(1S)-1-naphthalen-1-ylethyl]imidazol-1-ium chloride |
|---|---|
| PubChem CID | 156599776 |
| Molecular Formula | C27H25ClN2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1,3-bis[(1S)-1-naphthalen-1-ylethyl]imidazol-1-ium chloride |
| SMILES | C[C@@H](c1cccc2ccccc12)n1cc[n+]([C@@H](C)c2cccc3ccccc23)c1.[Cl-] |
| InChI | InChI=1S/C27H25N2.ClH/c1-20(24-15-7-11-22-9-3-5-13-26(22)24)28-17-18-29(19-28)21(2)25-16-8-12-23-10-4-6-14-27(23)25;/h3-21H,1-2H3;1H/q+1;/p-1/t20-,21-;/m0./s1 |
| InChIKey | WWHXAWYJVJOCDY-GUTACTQSSA-M |
| XLogP | 3.30 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|