C33H37N2+ — CID 71770977
1,3-bis[(1R)-2,2-dimethyl-1-naphthalen-1-ylpropyl]imidazol-1-ium (PubChem CID 71770977) has the molecular formula C33H37N2+ and a molecular weight of 461.67 g/mol. Its IUPAC name is 1,3-bis[(1R)-2,2-dimethyl-1-naphthalen-1-ylpropyl]imidazol-1-ium.
| Compound Name | 1,3-bis[(1R)-2,2-dimethyl-1-naphthalen-1-ylpropyl]imidazol-1-ium |
|---|---|
| PubChem CID | 71770977 |
| Molecular Formula | C33H37N2+ |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 1,3-bis[(1R)-2,2-dimethyl-1-naphthalen-1-ylpropyl]imidazol-1-ium |
| SMILES | CC(C)(C)[C@H](c1cccc2ccccc12)n1cc[n+]([C@@H](c2cccc3ccccc23)C(C)(C)C)c1 |
| InChI | InChI=1S/C33H37N2/c1-32(2,3)30(28-19-11-15-24-13-7-9-17-26(24)28)34-21-22-35(23-34)31(33(4,5)6)29-20-12-16-25-14-8-10-18-27(25)29/h7-23,30-31H,1-6H3/q+1/t30-,31-/m0/s1 |
| InChIKey | USBWUGXWICGYQK-CONSDPRKSA-N |
| XLogP | 8.35 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|