C33H39IN2 — CID 127262560
1,3-bis[(1S)-2,2-dimethyl-1-naphthalen-1-ylpropyl]-4,5-dihydroimidazol-1-ium iodide (PubChem CID 127262560) has the molecular formula C33H39IN2 and a molecular weight of 590.59 g/mol. Its IUPAC name is 1,3-bis[(1S)-2,2-dimethyl-1-naphthalen-1-ylpropyl]-4,5-dihydroimidazol-1-ium iodide.
| Compound Name | 1,3-bis[(1S)-2,2-dimethyl-1-naphthalen-1-ylpropyl]-4,5-dihydroimidazol-1-ium iodide |
|---|---|
| PubChem CID | 127262560 |
| Molecular Formula | C33H39IN2 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 1,3-bis[(1S)-2,2-dimethyl-1-naphthalen-1-ylpropyl]-4,5-dihydroimidazol-1-ium iodide |
| SMILES | CC(C)(C)[C@@H](c1cccc2ccccc12)N1C=[N+]([C@H](c2cccc3ccccc23)C(C)(C)C)CC1.[I-] |
| InChI | InChI=1S/C33H39N2.HI/c1-32(2,3)30(28-19-11-15-24-13-7-9-17-26(24)28)34-21-22-35(23-34)31(33(4,5)6)29-20-12-16-25-14-8-10-18-27(25)29;/h7-20,23,30-31H,21-22H2,1-6H3;1H/q+1;/p-1/t30-,31-;/m1./s1 |
| InChIKey | FBAXFNUYKXNWGQ-XBPPRYKJSA-M |
| XLogP | 5.23 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|