C26H30ClN3 — CID 10669781
(4S,5S)-N,1,3-trimethyl-4,5-diphenyl-N-[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium-2-amine chloride (PubChem CID 10669781) has the molecular formula C26H30ClN3 and a molecular weight of 420.00 g/mol. Its IUPAC name is (4S,5S)-N,1,3-trimethyl-4,5-diphenyl-N-[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium-2-amine chloride.
| Compound Name | (4S,5S)-N,1,3-trimethyl-4,5-diphenyl-N-[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium-2-amine chloride |
|---|---|
| PubChem CID | 10669781 |
| Molecular Formula | C26H30ClN3 |
| Molecular Weight | 420.00 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (4S,5S)-N,1,3-trimethyl-4,5-diphenyl-N-[(1R)-1-phenylethyl]-4,5-dihydroimidazol-1-ium-2-amine chloride |
| SMILES | C[C@H](c1ccccc1)N(C)C1=[N+](C)[C@@H](c2ccccc2)[C@H](c2ccccc2)N1C.[Cl-] |
| InChI | InChI=1S/C26H30N3.ClH/c1-20(21-14-8-5-9-15-21)27(2)26-28(3)24(22-16-10-6-11-17-22)25(29(26)4)23-18-12-7-13-19-23;/h5-20,24-25H,1-4H3;1H/q+1;/p-1/t20-,24+,25+;/m1./s1 |
| InChIKey | REJBMNDNWCROHI-OBKBMVPESA-M |
| XLogP | 2.11 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.00 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|