C49H51N2+ — CID 51357445
(4S,5S)-1,3-bis[bis(2,3-dimethylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium (PubChem CID 51357445) has the molecular formula C49H51N2+ and a molecular weight of 667.96 g/mol. Its IUPAC name is (4S,5S)-1,3-bis[bis(2,3-dimethylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium.
| Compound Name | (4S,5S)-1,3-bis[bis(2,3-dimethylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 51357445 |
| Molecular Formula | C49H51N2+ |
| Molecular Weight | 667.96 g/mol |
| Exact Mass | 667.40 |
| IUPAC Name | (4S,5S)-1,3-bis[bis(2,3-dimethylphenyl)methyl]-4,5-diphenyl-4,5-dihydroimidazol-1-ium |
| SMILES | Cc1cccc(C(c2cccc(C)c2C)N2C=[N+](C(c3cccc(C)c3C)c3cccc(C)c3C)[C@@H](c3ccccc3)[C@@H]2c2ccccc2)c1C |
| InChI | InChI=1S/C49H51N2/c1-32-19-15-27-42(36(32)5)48(43-28-16-20-33(2)37(43)6)50-31-51(47(41-25-13-10-14-26-41)46(50)40-23-11-9-12-24-40)49(44-29-17-21-34(3)38(44)7)45-30-18-22-35(4)39(45)8/h9-31,46-49H,1-8H3/q+1/t46-,47-/m0/s1 |
| InChIKey | XXMUXQFFJAZZON-MVRBIKRMSA-N |
| XLogP | 11.87 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.96 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|