C15H17P — CID 67637455
[(2,3-dimethylphenyl)-phenylmethyl]phosphane (PubChem CID 67637455) has the molecular formula C15H17P and a molecular weight of 228.28 g/mol. Its IUPAC name is [(2,3-dimethylphenyl)-phenylmethyl]phosphane.
| Compound Name | [(2,3-dimethylphenyl)-phenylmethyl]phosphane |
|---|---|
| PubChem CID | 67637455 |
| Molecular Formula | C15H17P |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [(2,3-dimethylphenyl)-phenylmethyl]phosphane |
| SMILES | Cc1cccc(C(P)c2ccccc2)c1C |
| InChI | InChI=1S/C15H17P/c1-11-7-6-10-14(12(11)2)15(16)13-8-4-3-5-9-13/h3-10,15H,16H2,1-2H3 |
| InChIKey | GDWXDFMXYKAOQA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|