About [(2,3-dimethylphenyl)-phenylmethyl]phosphane
[(2,3-dimethylphenyl)-phenylmethyl]phosphane (PubChem CID 67637455) has the molecular formula C15H17P
and a molecular weight of 228.28 g/mol. Its IUPAC name is [(2,3-dimethylphenyl)-phenylmethyl]phosphane.
Molecular Properties
| Compound Name | [(2,3-dimethylphenyl)-phenylmethyl]phosphane |
| PubChem CID | 67637455 |
| Molecular Formula | C15H17P |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | [(2,3-dimethylphenyl)-phenylmethyl]phosphane |
| SMILES | Cc1cccc(C(P)c2ccccc2)c1C |
| InChI | InChI=1S/C15H17P/c1-11-7-6-10-14(12(11)2)15(16)13-8-4-3-5-9-13/h3-10,15H,16H2,1-2H3 |
| InChIKey | GDWXDFMXYKAOQA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2,3-dimethylphenyl)-phenylmethyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,3-dimethylphenyl)-phenylmethyl]phosphane?
The IUPAC name of [(2,3-dimethylphenyl)-phenylmethyl]phosphane (CID 67637455) is [(2,3-dimethylphenyl)-phenylmethyl]phosphane.
What is the SMILES notation for [(2,3-dimethylphenyl)-phenylmethyl]phosphane?
The canonical SMILES for [(2,3-dimethylphenyl)-phenylmethyl]phosphane is Cc1cccc(C(P)c2ccccc2)c1C.
What is the InChIKey of [(2,3-dimethylphenyl)-phenylmethyl]phosphane?
The InChIKey is GDWXDFMXYKAOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17P/c1-11-7-6-10-14(12(11)2)15(16)13-8-4-3-5-9-13/h3-10,15H,16H2,1-2H3.
What are the key properties of [(2,3-dimethylphenyl)-phenylmethyl]phosphane?
[(2,3-dimethylphenyl)-phenylmethyl]phosphane has a molecular weight of 228.28 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,3-dimethylphenyl)-phenylmethyl]phosphane is sourced from PubChem (CID 67637455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).