C15H15Cl — CID 13105628
1-[chloro(phenyl)methyl]-2,3-dimethylbenzene (PubChem CID 13105628) has the molecular formula C15H15Cl and a molecular weight of 230.74 g/mol. Its IUPAC name is 1-[chloro(phenyl)methyl]-2,3-dimethylbenzene.
| Compound Name | 1-[chloro(phenyl)methyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 13105628 |
| Molecular Formula | C15H15Cl |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-[chloro(phenyl)methyl]-2,3-dimethylbenzene |
| SMILES | Cc1cccc(C(Cl)c2ccccc2)c1C |
| InChI | InChI=1S/C15H15Cl/c1-11-7-6-10-14(12(11)2)15(16)13-8-4-3-5-9-13/h3-10,15H,1-2H3 |
| InChIKey | WDCJXNOVLUBNOQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|