C20H18ClN — CID 54546741
4-[chloro-[2-(2,3-dimethylphenyl)phenyl]methyl]pyridine (PubChem CID 54546741) has the molecular formula C20H18ClN and a molecular weight of 307.82 g/mol. Its IUPAC name is 4-[chloro-[2-(2,3-dimethylphenyl)phenyl]methyl]pyridine.
| Compound Name | 4-[chloro-[2-(2,3-dimethylphenyl)phenyl]methyl]pyridine |
|---|---|
| PubChem CID | 54546741 |
| Molecular Formula | C20H18ClN |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-[chloro-[2-(2,3-dimethylphenyl)phenyl]methyl]pyridine |
| SMILES | Cc1cccc(-c2ccccc2C(Cl)c2ccncc2)c1C |
| InChI | InChI=1S/C20H18ClN/c1-14-6-5-9-17(15(14)2)18-7-3-4-8-19(18)20(21)16-10-12-22-13-11-16/h3-13,20H,1-2H3 |
| InChIKey | ZHAUIJPFXPFTRC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|