C15H17N — CID 146588490
3-(2,3-dimethylphenyl)-4,5-dimethylpyridine (PubChem CID 146588490) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-4,5-dimethylpyridine.
| Compound Name | 3-(2,3-dimethylphenyl)-4,5-dimethylpyridine |
|---|---|
| PubChem CID | 146588490 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-4,5-dimethylpyridine |
| SMILES | Cc1cccc(-c2cncc(C)c2C)c1C |
| InChI | InChI=1S/C15H17N/c1-10-6-5-7-14(12(10)3)15-9-16-8-11(2)13(15)4/h5-9H,1-4H3 |
| InChIKey | GTEFMHQPMKBNTM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |