C17H21OP — CID 87085516
[(4-methoxy-2,3,5-trimethylphenyl)-phenylmethyl]phosphane (PubChem CID 87085516) has the molecular formula C17H21OP and a molecular weight of 272.33 g/mol. Its IUPAC name is [(4-methoxy-2,3,5-trimethylphenyl)-phenylmethyl]phosphane.
| Compound Name | [(4-methoxy-2,3,5-trimethylphenyl)-phenylmethyl]phosphane |
|---|---|
| PubChem CID | 87085516 |
| Molecular Formula | C17H21OP |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [(4-methoxy-2,3,5-trimethylphenyl)-phenylmethyl]phosphane |
| SMILES | COc1c(C)cc(C(P)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C17H21OP/c1-11-10-15(12(2)13(3)16(11)18-4)17(19)14-8-6-5-7-9-14/h5-10,17H,19H2,1-4H3 |
| InChIKey | AICMJDUUTMOTNP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|