C12H19NO2 — CID 116954672
(4-methoxy-2,3,5-trimethylphenyl)-(methylamino)methanol (PubChem CID 116954672) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4-methoxy-2,3,5-trimethylphenyl)-(methylamino)methanol.
| Compound Name | (4-methoxy-2,3,5-trimethylphenyl)-(methylamino)methanol |
|---|---|
| PubChem CID | 116954672 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4-methoxy-2,3,5-trimethylphenyl)-(methylamino)methanol |
| SMILES | CNC(O)c1cc(C)c(OC)c(C)c1C |
| InChI | InChI=1S/C12H19NO2/c1-7-6-10(12(14)13-4)8(2)9(3)11(7)15-5/h6,12-14H,1-5H3 |
| InChIKey | LBYRUOZIWAIFIE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|