C22H29ClO2 — CID 88767616
1-[2-chloro-1-(4-methoxy-2,3,5-trimethylphenyl)ethyl]-4-methoxy-2,3,5-trimethylbenzene (PubChem CID 88767616) has the molecular formula C22H29ClO2 and a molecular weight of 360.93 g/mol. Its IUPAC name is 1-[2-chloro-1-(4-methoxy-2,3,5-trimethylphenyl)ethyl]-4-methoxy-2,3,5-trimethylbenzene.
| Compound Name | 1-[2-chloro-1-(4-methoxy-2,3,5-trimethylphenyl)ethyl]-4-methoxy-2,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 88767616 |
| Molecular Formula | C22H29ClO2 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-[2-chloro-1-(4-methoxy-2,3,5-trimethylphenyl)ethyl]-4-methoxy-2,3,5-trimethylbenzene |
| SMILES | COc1c(C)cc(C(CCl)c2cc(C)c(OC)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C22H29ClO2/c1-12-9-18(14(3)16(5)21(12)24-7)20(11-23)19-10-13(2)22(25-8)17(6)15(19)4/h9-10,20H,11H2,1-8H3 |
| InChIKey | VDBYGKHXUKHEPK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|