C11H16BrNO — CID 116947618
bromo-(4-methoxy-2,3,5-trimethylphenyl)methanamine (PubChem CID 116947618) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is bromo-(4-methoxy-2,3,5-trimethylphenyl)methanamine.
| Compound Name | bromo-(4-methoxy-2,3,5-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 116947618 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | bromo-(4-methoxy-2,3,5-trimethylphenyl)methanamine |
| SMILES | COc1c(C)cc(C(N)Br)c(C)c1C |
| InChI | InChI=1S/C11H16BrNO/c1-6-5-9(11(12)13)7(2)8(3)10(6)14-4/h5,11H,13H2,1-4H3 |
| InChIKey | DCTNYGYUPPLHSQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|