C30H35N2+ — CID 138964935
(4R,5S)-1-cyclohexyl-4,5-diphenyl-3-(2-propylphenyl)-4,5-dihydroimidazol-1-ium (PubChem CID 138964935) has the molecular formula C30H35N2+ and a molecular weight of 423.62 g/mol. Its IUPAC name is (4R,5S)-1-cyclohexyl-4,5-diphenyl-3-(2-propylphenyl)-4,5-dihydroimidazol-1-ium.
| Compound Name | (4R,5S)-1-cyclohexyl-4,5-diphenyl-3-(2-propylphenyl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 138964935 |
| Molecular Formula | C30H35N2+ |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (4R,5S)-1-cyclohexyl-4,5-diphenyl-3-(2-propylphenyl)-4,5-dihydroimidazol-1-ium |
| SMILES | CCCc1ccccc1N1C=[N+](C2CCCCC2)[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H35N2/c1-2-14-24-15-12-13-22-28(24)32-23-31(27-20-10-5-11-21-27)29(25-16-6-3-7-17-25)30(32)26-18-8-4-9-19-26/h3-4,6-9,12-13,15-19,22-23,27,29-30H,2,5,10-11,14,20-21H2,1H3/q+1/t29-,30+/m0/s1 |
| InChIKey | LUYWHAWNVOYEBT-XZWHSSHBSA-N |
| XLogP | 7.32 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|