C32H33N2O+ — CID 122382376
2-[[(4S,5S)-3-(2,6-diethylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium-1-yl]methyl]phenol (PubChem CID 122382376) has the molecular formula C32H33N2O+ and a molecular weight of 461.63 g/mol. Its IUPAC name is 2-[[(4S,5S)-3-(2,6-diethylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium-1-yl]methyl]phenol.
| Compound Name | 2-[[(4S,5S)-3-(2,6-diethylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 122382376 |
| Molecular Formula | C32H33N2O+ |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 2-[[(4S,5S)-3-(2,6-diethylphenyl)-4,5-diphenyl-4,5-dihydroimidazol-1-ium-1-yl]methyl]phenol |
| SMILES | CCc1cccc(CC)c1N1C=[N+](Cc2ccccc2O)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H32N2O/c1-3-24-19-13-20-25(4-2)30(24)34-23-33(22-28-18-11-12-21-29(28)35)31(26-14-7-5-8-15-26)32(34)27-16-9-6-10-17-27/h5-21,23,31-32H,3-4,22H2,1-2H3/p+1/t31-,32-/m0/s1 |
| InChIKey | LNBFAHUCDBKPNQ-ACHIHNKUSA-O |
| XLogP | 7.06 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|