C36H33N2+ — CID 164665493
(4S,5S)-4,5-diphenyl-1-(3-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium (PubChem CID 164665493) has the molecular formula C36H33N2+ and a molecular weight of 493.67 g/mol. Its IUPAC name is (4S,5S)-4,5-diphenyl-1-(3-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium.
| Compound Name | (4S,5S)-4,5-diphenyl-1-(3-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 164665493 |
| Molecular Formula | C36H33N2+ |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (4S,5S)-4,5-diphenyl-1-(3-phenylphenyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-3-ium |
| SMILES | Cc1cc(C)c([N+]2=CN(c3cccc(-c4ccccc4)c3)[C@@H](c3ccccc3)[C@@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C36H33N2/c1-26-22-27(2)34(28(3)23-26)38-25-37(33-21-13-20-32(24-33)29-14-7-4-8-15-29)35(30-16-9-5-10-17-30)36(38)31-18-11-6-12-19-31/h4-25,35-36H,1-3H3/q+1/t35-,36-/m0/s1 |
| InChIKey | KAZGHYQXTGASTG-ZPGRZCPFSA-N |
| XLogP | 8.95 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|