C30H30N2Si — CID 58249953
2,2,4,5-tetramethyl-1,3-bis(3-phenylphenyl)-1,3,2-diazasilole (PubChem CID 58249953) has the molecular formula C30H30N2Si and a molecular weight of 446.67 g/mol. Its IUPAC name is 2,2,4,5-tetramethyl-1,3-bis(3-phenylphenyl)-1,3,2-diazasilole.
| Compound Name | 2,2,4,5-tetramethyl-1,3-bis(3-phenylphenyl)-1,3,2-diazasilole |
|---|---|
| PubChem CID | 58249953 |
| Molecular Formula | C30H30N2Si |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2,2,4,5-tetramethyl-1,3-bis(3-phenylphenyl)-1,3,2-diazasilole |
| SMILES | CC1=C(C)N(c2cccc(-c3ccccc3)c2)[Si](C)(C)N1c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C30H30N2Si/c1-23-24(2)32(30-20-12-18-28(22-30)26-15-9-6-10-16-26)33(3,4)31(23)29-19-11-17-27(21-29)25-13-7-5-8-14-25/h5-22H,1-4H3 |
| InChIKey | GYUMZXSPWMZDQK-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|