C12H16NS+ — CID 176815481
(4R,5S)-2,3,5-trimethyl-4-phenyl-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 176815481) has the molecular formula C12H16NS+ and a molecular weight of 206.33 g/mol. Its IUPAC name is (4R,5S)-2,3,5-trimethyl-4-phenyl-4,5-dihydro-1,3-thiazol-3-ium.
| Compound Name | (4R,5S)-2,3,5-trimethyl-4-phenyl-4,5-dihydro-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 176815481 |
| Molecular Formula | C12H16NS+ |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (4R,5S)-2,3,5-trimethyl-4-phenyl-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | CC1=[N+](C)[C@H](c2ccccc2)[C@H](C)S1 |
| InChI | InChI=1S/C12H16NS/c1-9-12(13(3)10(2)14-9)11-7-5-4-6-8-11/h4-9,12H,1-3H3/q+1/t9-,12-/m0/s1 |
| InChIKey | RAHMYHSGNMPYGF-CABZTGNLSA-N |
| XLogP | 2.92 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|