C11H14N2 — CID 134952379
(6R)-2-methyl-6-phenyl-1,4,5,6-tetrahydropyrimidine (PubChem CID 134952379) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (6R)-2-methyl-6-phenyl-1,4,5,6-tetrahydropyrimidine.
| Compound Name | (6R)-2-methyl-6-phenyl-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 134952379 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (6R)-2-methyl-6-phenyl-1,4,5,6-tetrahydropyrimidine |
| SMILES | CC1=NCC[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C11H14N2/c1-9-12-8-7-11(13-9)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,12,13)/t11-/m1/s1 |
| InChIKey | XAFFTEZGPCOJLL-LLVKDONJSA-N |
| XLogP | 2.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |