C11H12N2S — CID 45056811
4-methyl-6-phenyl-5,6-dihydro-1H-pyrimidine-2-thione (PubChem CID 45056811) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 4-methyl-6-phenyl-5,6-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 4-methyl-6-phenyl-5,6-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 45056811 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-methyl-6-phenyl-5,6-dihydro-1H-pyrimidine-2-thione |
| SMILES | CC1=NC(=S)NC(c2ccccc2)C1 |
| InChI | InChI=1S/C11H12N2S/c1-8-7-10(13-11(14)12-8)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,13,14) |
| InChIKey | UNEFPMZZLBSZAN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|