C16H12N2S2 — CID 12830733
4,6-diphenyl-1,6-dihydropyrimidine-2,5-dithione (PubChem CID 12830733) has the molecular formula C16H12N2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4,6-diphenyl-1,6-dihydropyrimidine-2,5-dithione.
| Compound Name | 4,6-diphenyl-1,6-dihydropyrimidine-2,5-dithione |
|---|---|
| PubChem CID | 12830733 |
| Molecular Formula | C16H12N2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4,6-diphenyl-1,6-dihydropyrimidine-2,5-dithione |
| SMILES | S=C1N=C(c2ccccc2)C(=S)C(c2ccccc2)N1 |
| InChI | InChI=1S/C16H12N2S2/c19-15-13(11-7-3-1-4-8-11)17-16(20)18-14(15)12-9-5-2-6-10-12/h1-10,13H,(H,17,20) |
| InChIKey | UUOJBJFKBBBKKH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|